C20H17N3O2 — CID 67425972
4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]but-3-yn-2-ol (PubChem CID 67425972) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]but-3-yn-2-ol.
| Compound Name | 4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 67425972 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]but-3-yn-2-ol |
| SMILES | CC(O)C#Cc1cccnc1Oc1ccc(Nc2ccccn2)cc1 |
| InChI | InChI=1S/C20H17N3O2/c1-15(24)7-8-16-5-4-14-22-20(16)25-18-11-9-17(10-12-18)23-19-6-2-3-13-21-19/h2-6,9-15,24H,1H3,(H,21,23) |
| InChIKey | PLZWZJSKWCEZIS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|