C24H15Cl2NO3S — CID 67426759
5-[3-(N-(2,4-dichlorobenzoyl)anilino)phenyl]thiophene-2-carboxylic acid (PubChem CID 67426759) has the molecular formula C24H15Cl2NO3S and a molecular weight of 468.36 g/mol. Its IUPAC name is 5-[3-(N-(2,4-dichlorobenzoyl)anilino)phenyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-(N-(2,4-dichlorobenzoyl)anilino)phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67426759 |
| Molecular Formula | C24H15Cl2NO3S |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | 5-[3-(N-(2,4-dichlorobenzoyl)anilino)phenyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2cccc(N(C(=O)c3ccc(Cl)cc3Cl)c3ccccc3)c2)s1 |
| InChI | InChI=1S/C24H15Cl2NO3S/c25-16-9-10-19(20(26)14-16)23(28)27(17-6-2-1-3-7-17)18-8-4-5-15(13-18)21-11-12-22(31-21)24(29)30/h1-14H,(H,29,30) |
| InChIKey | XROVTACVIJAJSV-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |