C18H11Cl2NO4S — CID 149295665
5-[4-(2-carboxyanilino)-3,5-dichlorophenyl]thiophene-2-carboxylic acid (PubChem CID 149295665) has the molecular formula C18H11Cl2NO4S and a molecular weight of 408.26 g/mol. Its IUPAC name is 5-[4-(2-carboxyanilino)-3,5-dichlorophenyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[4-(2-carboxyanilino)-3,5-dichlorophenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 149295665 |
| Molecular Formula | C18H11Cl2NO4S |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | 5-[4-(2-carboxyanilino)-3,5-dichlorophenyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2cc(Cl)c(Nc3ccccc3C(=O)O)c(Cl)c2)s1 |
| InChI | InChI=1S/C18H11Cl2NO4S/c19-11-7-9(14-5-6-15(26-14)18(24)25)8-12(20)16(11)21-13-4-2-1-3-10(13)17(22)23/h1-8,21H,(H,22,23)(H,24,25) |
| InChIKey | XVSRNQOQICIAGA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |