C14H11Cl2NO4 — CID 163038116
2-[2,6-dichloro-4-hydroxy-3-(hydroxymethyl)anilino]benzoic acid (PubChem CID 163038116) has the molecular formula C14H11Cl2NO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-hydroxy-3-(hydroxymethyl)anilino]benzoic acid.
| Compound Name | 2-[2,6-dichloro-4-hydroxy-3-(hydroxymethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 163038116 |
| Molecular Formula | C14H11Cl2NO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-[2,6-dichloro-4-hydroxy-3-(hydroxymethyl)anilino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1c(Cl)cc(O)c(CO)c1Cl |
| InChI | InChI=1S/C14H11Cl2NO4/c15-9-5-11(19)8(6-18)12(16)13(9)17-10-4-2-1-3-7(10)14(20)21/h1-5,17-19H,6H2,(H,20,21) |
| InChIKey | MYSHRPXOZJHKOQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|