About 2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid
2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid (PubChem CID 67427153) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid.
Analyze 2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The IUPAC name of 2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid (CID 67427153) is 2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid.
What is the SMILES notation for 2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The canonical SMILES for 2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid is O=C(O)CC1(O)CNc2ncccc21.
What is the InChIKey of 2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The InChIKey is VRTIGLYWSVBZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c12-7(13)4-9(14)5-11-8-6(9)2-1-3-10-8/h1-3,14H,4-5H2,(H,10,11)(H,12,13).
What are the key properties of 2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid?
2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid has a molecular weight of 194.19 g/mol, XLogP of 0.17, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxy-1,2-dihydropyrrolo[2,3-b]pyridin-3-yl)acetic acid is sourced from PubChem (CID 67427153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).