C14H12N2O4S — CID 67428669
3-hydroxy-5-(6-methoxyimidazo[1,2-a]pyridin-3-yl)-4-methylthiophene-2-carboxylic acid (PubChem CID 67428669) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 3-hydroxy-5-(6-methoxyimidazo[1,2-a]pyridin-3-yl)-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-hydroxy-5-(6-methoxyimidazo[1,2-a]pyridin-3-yl)-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67428669 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-hydroxy-5-(6-methoxyimidazo[1,2-a]pyridin-3-yl)-4-methylthiophene-2-carboxylic acid |
| SMILES | COc1ccc2ncc(-c3sc(C(=O)O)c(O)c3C)n2c1 |
| InChI | InChI=1S/C14H12N2O4S/c1-7-11(17)13(14(18)19)21-12(7)9-5-15-10-4-3-8(20-2)6-16(9)10/h3-6,17H,1-2H3,(H,18,19) |
| InChIKey | PFSKQNUBZYIBBY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|