methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate

C10H10N2O3 — CID 76849605

IUPACmethyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate
SMILESCOC(=O)c1cnc2ccc(OC)cn12
InChIInChI=1S/C10H10N2O3/c1-14-7-3-4-9-11-5-8(10(13)15-2)12(9)6-7/h3-6H,1-2H3
InChIKeyKWAMEKKPYGIVNT-UHFFFAOYSA-N
MW206.20 g/mol
LogP1.13
Rot. Bonds2

About methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate

methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 76849605) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate
PubChem CID76849605
Molecular FormulaC10H10N2O3
Molecular Weight206.20 g/mol
Exact Mass206.07
IUPAC Namemethyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate
SMILESCOC(=O)c1cnc2ccc(OC)cn12
InChIInChI=1S/C10H10N2O3/c1-14-7-3-4-9-11-5-8(10(13)15-2)12(9)6-7/h3-6H,1-2H3
InChIKeyKWAMEKKPYGIVNT-UHFFFAOYSA-N
XLogP1.13
TPSA52.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.20
LogP ≤ 51.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate?
The IUPAC name of methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate (CID 76849605) is methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate?
The canonical SMILES for methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate is COC(=O)c1cnc2ccc(OC)cn12.
What is the InChIKey of methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate?
The InChIKey is KWAMEKKPYGIVNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3/c1-14-7-3-4-9-11-5-8(10(13)15-2)12(9)6-7/h3-6H,1-2H3.
What are the key properties of methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate?
methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate has a molecular weight of 206.20 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methoxyimidazo[1,2-a]pyridine-3-carboxylate is sourced from PubChem (CID 76849605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).