C19H20O3 — CID 67429420
3-cyclopropyl-2-[[4-[(1S)-1-hydroxyethyl]phenyl]methyl]benzoic acid (PubChem CID 67429420) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-cyclopropyl-2-[[4-[(1S)-1-hydroxyethyl]phenyl]methyl]benzoic acid.
| Compound Name | 3-cyclopropyl-2-[[4-[(1S)-1-hydroxyethyl]phenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 67429420 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 3-cyclopropyl-2-[[4-[(1S)-1-hydroxyethyl]phenyl]methyl]benzoic acid |
| SMILES | C[C@H](O)c1ccc(Cc2c(C(=O)O)cccc2C2CC2)cc1 |
| InChI | InChI=1S/C19H20O3/c1-12(20)14-7-5-13(6-8-14)11-18-16(15-9-10-15)3-2-4-17(18)19(21)22/h2-8,12,15,20H,9-11H2,1H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | HBTRLRPTCBXSOZ-LBPRGKRZSA-N |
| XLogP | 3.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |