C21H22ClN7O3S — CID 67430768
[N'-[1-[5-[3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]-5-methylphenyl]-1,3-thiazol-2-yl]cyclobutyl]carbamimidoyl] carbamate (PubChem CID 67430768) has the molecular formula C21H22ClN7O3S and a molecular weight of 487.97 g/mol. Its IUPAC name is [N'-[1-[5-[3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]-5-methylphenyl]-1,3-thiazol-2-yl]cyclobutyl]carbamimidoyl] carbamate.
| Compound Name | [N'-[1-[5-[3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]-5-methylphenyl]-1,3-thiazol-2-yl]cyclobutyl]carbamimidoyl] carbamate |
|---|---|
| PubChem CID | 67430768 |
| Molecular Formula | C21H22ClN7O3S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | [N'-[1-[5-[3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]-5-methylphenyl]-1,3-thiazol-2-yl]cyclobutyl]carbamimidoyl] carbamate |
| SMILES | COc1nc(Nc2cc(C)cc(-c3cnc(C4(/N=C(\N)OC(N)=O)CCC4)s3)c2)ncc1Cl |
| InChI | InChI=1S/C21H22ClN7O3S/c1-11-6-12(8-13(7-11)27-20-26-9-14(22)16(28-20)31-2)15-10-25-17(33-15)21(4-3-5-21)29-18(23)32-19(24)30/h6-10H,3-5H2,1-2H3,(H2,23,29)(H2,24,30)(H,26,27,28) |
| InChIKey | YCUBIQSOBJYNNQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 150.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|