About 1H-1,2-benzodiazepine;1-pentylsulfonylpentane
1H-1,2-benzodiazepine;1-pentylsulfonylpentane (PubChem CID 67431612) has the molecular formula C19H30N2O2S
and a molecular weight of 350.53 g/mol. Its IUPAC name is 1H-1,2-benzodiazepine;1-pentylsulfonylpentane.
Molecular Properties
| Compound Name | 1H-1,2-benzodiazepine;1-pentylsulfonylpentane |
| PubChem CID | 67431612 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1H-1,2-benzodiazepine;1-pentylsulfonylpentane |
| SMILES | C1=Cc2ccccc2NN=C1.CCCCCS(=O)(=O)CCCCC |
| InChI | InChI=1S/C10H22O2S.C9H8N2/c1-3-5-7-9-13(11,12)10-8-6-4-2;1-2-6-9-8(4-1)5-3-7-10-11-9/h3-10H2,1-2H3;1-7,11H |
| InChIKey | UGAJGGVLKHXCIO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1H-1,2-benzodiazepine;1-pentylsulfonylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-1,2-benzodiazepine;1-pentylsulfonylpentane?
The IUPAC name of 1H-1,2-benzodiazepine;1-pentylsulfonylpentane (CID 67431612) is 1H-1,2-benzodiazepine;1-pentylsulfonylpentane.
What is the SMILES notation for 1H-1,2-benzodiazepine;1-pentylsulfonylpentane?
The canonical SMILES for 1H-1,2-benzodiazepine;1-pentylsulfonylpentane is C1=Cc2ccccc2NN=C1.CCCCCS(=O)(=O)CCCCC.
What is the InChIKey of 1H-1,2-benzodiazepine;1-pentylsulfonylpentane?
The InChIKey is UGAJGGVLKHXCIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O2S.C9H8N2/c1-3-5-7-9-13(11,12)10-8-6-4-2;1-2-6-9-8(4-1)5-3-7-10-11-9/h3-10H2,1-2H3;1-7,11H.
What are the key properties of 1H-1,2-benzodiazepine;1-pentylsulfonylpentane?
1H-1,2-benzodiazepine;1-pentylsulfonylpentane has a molecular weight of 350.53 g/mol, XLogP of 4.89, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-1,2-benzodiazepine;1-pentylsulfonylpentane is sourced from PubChem (CID 67431612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).