C26H31F2N3O5S — CID 67435046
(2R)-2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]-N-[5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrazin-2-yl]propanamide (PubChem CID 67435046) has the molecular formula C26H31F2N3O5S and a molecular weight of 535.61 g/mol. Its IUPAC name is (2R)-2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]-N-[5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrazin-2-yl]propanamide.
| Compound Name | (2R)-2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]-N-[5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrazin-2-yl]propanamide |
|---|---|
| PubChem CID | 67435046 |
| Molecular Formula | C26H31F2N3O5S |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | (2R)-2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]-N-[5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pyrazin-2-yl]propanamide |
| SMILES | CC1(C)OC[C@@H](c2cnc(NC(=O)[C@H](CC3C[C@@H](F)[C@@H](F)C3)c3ccc(S(=O)(=O)C4CC4)cc3)cn2)O1 |
| InChI | InChI=1S/C26H31F2N3O5S/c1-26(2)35-14-23(36-26)22-12-30-24(13-29-22)31-25(32)19(9-15-10-20(27)21(28)11-15)16-3-5-17(6-4-16)37(33,34)18-7-8-18/h3-6,12-13,15,18-21,23H,7-11,14H2,1-2H3,(H,30,31,32)/t15?,19-,20-,21+,23+/m1/s1 |
| InChIKey | SSJROBFTBSQTDZ-FGWRPSTBSA-N |
| XLogP | 4.44 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |