C28H39N3O3 — CID 67438225
(2S)-N-[(2R)-2-[4-(2-methylpentoxy)phenyl]-2-(2-phenylpropanoylamino)ethyl]pyrrolidine-2-carboxamide (PubChem CID 67438225) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is (2S)-N-[(2R)-2-[4-(2-methylpentoxy)phenyl]-2-(2-phenylpropanoylamino)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2R)-2-[4-(2-methylpentoxy)phenyl]-2-(2-phenylpropanoylamino)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67438225 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | (2S)-N-[(2R)-2-[4-(2-methylpentoxy)phenyl]-2-(2-phenylpropanoylamino)ethyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC(C)COc1ccc([C@H](CNC(=O)[C@@H]2CCCN2)NC(=O)C(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H39N3O3/c1-4-9-20(2)19-34-24-15-13-23(14-16-24)26(18-30-28(33)25-12-8-17-29-25)31-27(32)21(3)22-10-6-5-7-11-22/h5-7,10-11,13-16,20-21,25-26,29H,4,8-9,12,17-19H2,1-3H3,(H,30,33)(H,31,32)/t20?,21?,25-,26-/m0/s1 |
| InChIKey | DNPVFKNEACMXLY-LYCIREHVSA-N |
| XLogP | 4.33 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |