C25H33IN2O3 — CID 129058709
N-[(2R)-2-[(2-iodo-2-phenylacetyl)amino]-2-[4-(2-methylpentoxy)phenyl]ethyl]propanamide (PubChem CID 129058709) has the molecular formula C25H33IN2O3 and a molecular weight of 536.45 g/mol. Its IUPAC name is N-[(2R)-2-[(2-iodo-2-phenylacetyl)amino]-2-[4-(2-methylpentoxy)phenyl]ethyl]propanamide.
| Compound Name | N-[(2R)-2-[(2-iodo-2-phenylacetyl)amino]-2-[4-(2-methylpentoxy)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 129058709 |
| Molecular Formula | C25H33IN2O3 |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | N-[(2R)-2-[(2-iodo-2-phenylacetyl)amino]-2-[4-(2-methylpentoxy)phenyl]ethyl]propanamide |
| SMILES | CCCC(C)COc1ccc([C@H](CNC(=O)CC)NC(=O)C(I)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H33IN2O3/c1-4-9-18(3)17-31-21-14-12-19(13-15-21)22(16-27-23(29)5-2)28-25(30)24(26)20-10-7-6-8-11-20/h6-8,10-15,18,22,24H,4-5,9,16-17H2,1-3H3,(H,27,29)(H,28,30)/t18?,22-,24?/m0/s1 |
| InChIKey | KSNBTCYEYYVLHV-IGSLEHJCSA-N |
| XLogP | 5.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|