C29H42N2O3 — CID 129058708
3-methyl-N-[(2R)-2-[4-(2-methylpentoxy)phenyl]-4-[(2-phenylacetyl)amino]butyl]butanamide (PubChem CID 129058708) has the molecular formula C29H42N2O3 and a molecular weight of 466.67 g/mol. Its IUPAC name is 3-methyl-N-[(2R)-2-[4-(2-methylpentoxy)phenyl]-4-[(2-phenylacetyl)amino]butyl]butanamide.
| Compound Name | 3-methyl-N-[(2R)-2-[4-(2-methylpentoxy)phenyl]-4-[(2-phenylacetyl)amino]butyl]butanamide |
|---|---|
| PubChem CID | 129058708 |
| Molecular Formula | C29H42N2O3 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | 3-methyl-N-[(2R)-2-[4-(2-methylpentoxy)phenyl]-4-[(2-phenylacetyl)amino]butyl]butanamide |
| SMILES | CCCC(C)COc1ccc([C@@H](CCNC(=O)Cc2ccccc2)CNC(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C29H42N2O3/c1-5-9-23(4)21-34-27-14-12-25(13-15-27)26(20-31-28(32)18-22(2)3)16-17-30-29(33)19-24-10-7-6-8-11-24/h6-8,10-15,22-23,26H,5,9,16-21H2,1-4H3,(H,30,33)(H,31,32)/t23?,26-/m0/s1 |
| InChIKey | LFDRVOBEUPYRTJ-NASUQTAISA-N |
| XLogP | 5.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |