About methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate
methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate (PubChem CID 67441593) has the molecular formula C19H19BrFNO2
and a molecular weight of 392.27 g/mol. Its IUPAC name is methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate |
| PubChem CID | 67441593 |
| Molecular Formula | C19H19BrFNO2 |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate |
| SMILES | COC(=O)c1cc(F)cc2c1CC(C)(C)C(c1cccc(Br)c1)N2 |
| InChI | InChI=1S/C19H19BrFNO2/c1-19(2)10-15-14(18(23)24-3)8-13(21)9-16(15)22-17(19)11-5-4-6-12(20)7-11/h4-9,17,22H,10H2,1-3H3 |
| InChIKey | FUBJJXVJNHWUOO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate?
The IUPAC name of methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate (CID 67441593) is methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate.
What is the SMILES notation for methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate?
The canonical SMILES for methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate is COC(=O)c1cc(F)cc2c1CC(C)(C)C(c1cccc(Br)c1)N2.
What is the InChIKey of methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate?
The InChIKey is FUBJJXVJNHWUOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrFNO2/c1-19(2)10-15-14(18(23)24-3)8-13(21)9-16(15)22-17(19)11-5-4-6-12(20)7-11/h4-9,17,22H,10H2,1-3H3.
What are the key properties of methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate?
methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate has a molecular weight of 392.27 g/mol, XLogP of 5.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-bromophenyl)-7-fluoro-3,3-dimethyl-2,4-dihydro-1H-quinoline-5-carboxylate is sourced from PubChem (CID 67441593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).