C28H25FN4O2S — CID 67443101
(2S)-2-[7-[4-[2-(4-fluorophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]propanoic acid (PubChem CID 67443101) has the molecular formula C28H25FN4O2S and a molecular weight of 500.60 g/mol. Its IUPAC name is (2S)-2-[7-[4-[2-(4-fluorophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]propanoic acid.
| Compound Name | (2S)-2-[7-[4-[2-(4-fluorophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]propanoic acid |
|---|---|
| PubChem CID | 67443101 |
| Molecular Formula | C28H25FN4O2S |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (2S)-2-[7-[4-[2-(4-fluorophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]propanoic acid |
| SMILES | Cc1sc2c(c1C)C(c1ccc(C=Cc3ccc(F)cc3)cc1)=NC([C@H](C)C(=O)O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C28H25FN4O2S/c1-15-17(3)36-27-23(15)25(30-24(16(2)28(34)35)26-32-31-18(4)33(26)27)21-11-7-19(8-12-21)5-6-20-9-13-22(29)14-10-20/h5-14,16,24H,1-4H3,(H,34,35)/t16-,24?/m0/s1 |
| InChIKey | ZPWWFFVPUWZDJM-FXIRQEPWSA-N |
| XLogP | 6.18 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|