C29H25N5O2S — CID 67445035
(2S)-2-[7-[4-[2-(3-cyanophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]propanoic acid (PubChem CID 67445035) has the molecular formula C29H25N5O2S and a molecular weight of 507.62 g/mol. Its IUPAC name is (2S)-2-[7-[4-[2-(3-cyanophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]propanoic acid.
| Compound Name | (2S)-2-[7-[4-[2-(3-cyanophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]propanoic acid |
|---|---|
| PubChem CID | 67445035 |
| Molecular Formula | C29H25N5O2S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | (2S)-2-[7-[4-[2-(3-cyanophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]propanoic acid |
| SMILES | Cc1sc2c(c1C)C(c1ccc(C=Cc3cccc(C#N)c3)cc1)=NC([C@H](C)C(=O)O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C29H25N5O2S/c1-16-18(3)37-28-24(16)26(31-25(17(2)29(35)36)27-33-32-19(4)34(27)28)23-12-10-20(11-13-23)8-9-21-6-5-7-22(14-21)15-30/h5-14,17,25H,1-4H3,(H,35,36)/t17-,25?/m0/s1 |
| InChIKey | MXRVDQPHDMLIRW-LFUZPPSTSA-N |
| XLogP | 5.91 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|