C21H27N3O4 — CID 67445783
2-[[2-[4-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperazin-1-yl]-3-pyridinyl]methoxy]ethanol (PubChem CID 67445783) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-[[2-[4-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperazin-1-yl]-3-pyridinyl]methoxy]ethanol.
| Compound Name | 2-[[2-[4-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperazin-1-yl]-3-pyridinyl]methoxy]ethanol |
|---|---|
| PubChem CID | 67445783 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2-[[2-[4-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperazin-1-yl]-3-pyridinyl]methoxy]ethanol |
| SMILES | OCCOCc1cccnc1N1CCN(C[C@H]2COc3ccccc3O2)CC1 |
| InChI | InChI=1S/C21H27N3O4/c25-12-13-26-15-17-4-3-7-22-21(17)24-10-8-23(9-11-24)14-18-16-27-19-5-1-2-6-20(19)28-18/h1-7,18,25H,8-16H2/t18-/m0/s1 |
| InChIKey | IVKZLZOBRFJWRS-SFHVURJKSA-N |
| XLogP | 1.55 |
| TPSA | 67.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|