C20H21N5O2 — CID 67447946
3-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]amino]-N-methylbenzamide (PubChem CID 67447946) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]amino]-N-methylbenzamide.
| Compound Name | 3-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 67447946 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]amino]-N-methylbenzamide |
| SMILES | CCNC(=O)Nc1cc2cccc(Nc3cccc(C(=O)NC)c3)c2cn1 |
| InChI | InChI=1S/C20H21N5O2/c1-3-22-20(27)25-18-11-13-6-5-9-17(16(13)12-23-18)24-15-8-4-7-14(10-15)19(26)21-2/h4-12,24H,3H2,1-2H3,(H,21,26)(H2,22,23,25,27) |
| InChIKey | UHCYDGOIKRXCAU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |