C23H26N4O3 — CID 67449051
tert-butyl 4-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]amino]benzoate (PubChem CID 67449051) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is tert-butyl 4-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]amino]benzoate.
| Compound Name | tert-butyl 4-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]amino]benzoate |
|---|---|
| PubChem CID | 67449051 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | tert-butyl 4-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]amino]benzoate |
| SMILES | CCNC(=O)Nc1cc2cccc(Nc3ccc(C(=O)OC(C)(C)C)cc3)c2cn1 |
| InChI | InChI=1S/C23H26N4O3/c1-5-24-22(29)27-20-13-16-7-6-8-19(18(16)14-25-20)26-17-11-9-15(10-12-17)21(28)30-23(2,3)4/h6-14,26H,5H2,1-4H3,(H2,24,25,27,29) |
| InChIKey | ZGIDYDJKDJCZSX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |