C16H26N4O3 — CID 67448727
3-amino-4-(2-methoxyethylamino)-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 67448727) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-amino-4-(2-methoxyethylamino)-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 3-amino-4-(2-methoxyethylamino)-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 67448727 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 3-amino-4-(2-methoxyethylamino)-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | COCCNc1ccc(C(=O)NCCN2CCOCC2)cc1N |
| InChI | InChI=1S/C16H26N4O3/c1-22-9-5-18-15-3-2-13(12-14(15)17)16(21)19-4-6-20-7-10-23-11-8-20/h2-3,12,18H,4-11,17H2,1H3,(H,19,21) |
| InChIKey | RRHTWEDKLXRRDA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|