C18H17NO4 — CID 67449340
1-[4-(phenylmethoxymethoxy)phenyl]pyrrolidine-2,4-dione (PubChem CID 67449340) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 1-[4-(phenylmethoxymethoxy)phenyl]pyrrolidine-2,4-dione.
| Compound Name | 1-[4-(phenylmethoxymethoxy)phenyl]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 67449340 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-[4-(phenylmethoxymethoxy)phenyl]pyrrolidine-2,4-dione |
| SMILES | O=C1CC(=O)N(c2ccc(OCOCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C18H17NO4/c20-16-10-18(21)19(11-16)15-6-8-17(9-7-15)23-13-22-12-14-4-2-1-3-5-14/h1-9H,10-13H2 |
| InChIKey | OJKCUDKGIXKAEK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|