C23H22N6O — CID 67450257
1-ethyl-3-[8-[(6-methyl-2-pyridinyl)amino]-5-pyridin-4-ylisoquinolin-3-yl]urea (PubChem CID 67450257) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-ethyl-3-[8-[(6-methyl-2-pyridinyl)amino]-5-pyridin-4-ylisoquinolin-3-yl]urea.
| Compound Name | 1-ethyl-3-[8-[(6-methyl-2-pyridinyl)amino]-5-pyridin-4-ylisoquinolin-3-yl]urea |
|---|---|
| PubChem CID | 67450257 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-ethyl-3-[8-[(6-methyl-2-pyridinyl)amino]-5-pyridin-4-ylisoquinolin-3-yl]urea |
| SMILES | CCNC(=O)Nc1cc2c(-c3ccncc3)ccc(Nc3cccc(C)n3)c2cn1 |
| InChI | InChI=1S/C23H22N6O/c1-3-25-23(30)29-22-13-18-17(16-9-11-24-12-10-16)7-8-20(19(18)14-26-22)28-21-6-4-5-15(2)27-21/h4-14H,3H2,1-2H3,(H,27,28)(H2,25,26,29,30) |
| InChIKey | MSKLTXMPYAOHNI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |