C17H16ClN5O — CID 67450364
1-[5-chloro-8-(pyridin-3-ylamino)isoquinolin-3-yl]-3-ethylurea (PubChem CID 67450364) has the molecular formula C17H16ClN5O and a molecular weight of 341.80 g/mol. Its IUPAC name is 1-[5-chloro-8-(pyridin-3-ylamino)isoquinolin-3-yl]-3-ethylurea.
| Compound Name | 1-[5-chloro-8-(pyridin-3-ylamino)isoquinolin-3-yl]-3-ethylurea |
|---|---|
| PubChem CID | 67450364 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-[5-chloro-8-(pyridin-3-ylamino)isoquinolin-3-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1cc2c(Cl)ccc(Nc3cccnc3)c2cn1 |
| InChI | InChI=1S/C17H16ClN5O/c1-2-20-17(24)23-16-8-12-13(10-21-16)15(6-5-14(12)18)22-11-4-3-7-19-9-11/h3-10,22H,2H2,1H3,(H2,20,21,23,24) |
| InChIKey | XGXYJLKQHNJGQL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |