C20H19ClN6O2 — CID 71622215
4-(3-chloroanilino)-6-(ethylcarbamoylamino)-N-pyridin-3-ylpyridine-3-carboxamide (PubChem CID 71622215) has the molecular formula C20H19ClN6O2 and a molecular weight of 410.87 g/mol. Its IUPAC name is 4-(3-chloroanilino)-6-(ethylcarbamoylamino)-N-pyridin-3-ylpyridine-3-carboxamide.
| Compound Name | 4-(3-chloroanilino)-6-(ethylcarbamoylamino)-N-pyridin-3-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71622215 |
| Molecular Formula | C20H19ClN6O2 |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-(3-chloroanilino)-6-(ethylcarbamoylamino)-N-pyridin-3-ylpyridine-3-carboxamide |
| SMILES | CCNC(=O)Nc1cc(Nc2cccc(Cl)c2)c(C(=O)Nc2cccnc2)cn1 |
| InChI | InChI=1S/C20H19ClN6O2/c1-2-23-20(29)27-18-10-17(25-14-6-3-5-13(21)9-14)16(12-24-18)19(28)26-15-7-4-8-22-11-15/h3-12H,2H2,1H3,(H,26,28)(H3,23,24,25,27,29) |
| InChIKey | MCOACGFNYKYOHE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |