C26H32N5O5P — CID 129094660
3-[4-[[4-anilino-6-(ethylcarbamoylamino)pyridine-3-carbonyl]amino]phenyl]pentan-3-ylphosphonic acid (PubChem CID 129094660) has the molecular formula C26H32N5O5P and a molecular weight of 525.55 g/mol. Its IUPAC name is 3-[4-[[4-anilino-6-(ethylcarbamoylamino)pyridine-3-carbonyl]amino]phenyl]pentan-3-ylphosphonic acid.
| Compound Name | 3-[4-[[4-anilino-6-(ethylcarbamoylamino)pyridine-3-carbonyl]amino]phenyl]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 129094660 |
| Molecular Formula | C26H32N5O5P |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 3-[4-[[4-anilino-6-(ethylcarbamoylamino)pyridine-3-carbonyl]amino]phenyl]pentan-3-ylphosphonic acid |
| SMILES | CCNC(=O)Nc1cc(Nc2ccccc2)c(C(=O)Nc2ccc(C(CC)(CC)P(=O)(O)O)cc2)cn1 |
| InChI | InChI=1S/C26H32N5O5P/c1-4-26(5-2,37(34,35)36)18-12-14-20(15-13-18)30-24(32)21-17-28-23(31-25(33)27-6-3)16-22(21)29-19-10-8-7-9-11-19/h7-17H,4-6H2,1-3H3,(H,30,32)(H2,34,35,36)(H3,27,28,29,31,33) |
| InChIKey | VZXYJAAAHYSEGV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|