C19H23N5O3 — CID 71621323
1-[4-anilino-5-(morpholine-4-carbonyl)-2-pyridinyl]-3-ethylurea (PubChem CID 71621323) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 1-[4-anilino-5-(morpholine-4-carbonyl)-2-pyridinyl]-3-ethylurea.
| Compound Name | 1-[4-anilino-5-(morpholine-4-carbonyl)-2-pyridinyl]-3-ethylurea |
|---|---|
| PubChem CID | 71621323 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 1-[4-anilino-5-(morpholine-4-carbonyl)-2-pyridinyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1cc(Nc2ccccc2)c(C(=O)N2CCOCC2)cn1 |
| InChI | InChI=1S/C19H23N5O3/c1-2-20-19(26)23-17-12-16(22-14-6-4-3-5-7-14)15(13-21-17)18(25)24-8-10-27-11-9-24/h3-7,12-13H,2,8-11H2,1H3,(H3,20,21,22,23,26) |
| InChIKey | AZLQFLSLLWASJC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |