C19H18ClFN4O — CID 67448398
1-[6-(benzylamino)-8-chloro-5-fluoroisoquinolin-3-yl]-3-ethylurea (PubChem CID 67448398) has the molecular formula C19H18ClFN4O and a molecular weight of 372.83 g/mol. Its IUPAC name is 1-[6-(benzylamino)-8-chloro-5-fluoroisoquinolin-3-yl]-3-ethylurea.
| Compound Name | 1-[6-(benzylamino)-8-chloro-5-fluoroisoquinolin-3-yl]-3-ethylurea |
|---|---|
| PubChem CID | 67448398 |
| Molecular Formula | C19H18ClFN4O |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-[6-(benzylamino)-8-chloro-5-fluoroisoquinolin-3-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1cc2c(F)c(NCc3ccccc3)cc(Cl)c2cn1 |
| InChI | InChI=1S/C19H18ClFN4O/c1-2-22-19(26)25-17-8-13-14(11-24-17)15(20)9-16(18(13)21)23-10-12-6-4-3-5-7-12/h3-9,11,23H,2,10H2,1H3,(H2,22,24,25,26) |
| InChIKey | JRLDLYXLKFDHDA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |