C19H19N5O2 — CID 66576180
N-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]methyl]pyridine-2-carboxamide (PubChem CID 66576180) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]methyl]pyridine-2-carboxamide.
| Compound Name | N-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 66576180 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]methyl]pyridine-2-carboxamide |
| SMILES | CCNC(=O)Nc1cc2cccc(CNC(=O)c3ccccn3)c2cn1 |
| InChI | InChI=1S/C19H19N5O2/c1-2-20-19(26)24-17-10-13-6-5-7-14(15(13)12-22-17)11-23-18(25)16-8-3-4-9-21-16/h3-10,12H,2,11H2,1H3,(H,23,25)(H2,20,22,24,26) |
| InChIKey | TYXBOLHZGZSRIW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |