C20H21N5O3 — CID 66576184
pyridin-3-ylmethyl N-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]methyl]carbamate (PubChem CID 66576184) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]methyl]carbamate.
| Compound Name | pyridin-3-ylmethyl N-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]methyl]carbamate |
|---|---|
| PubChem CID | 66576184 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | pyridin-3-ylmethyl N-[[3-(ethylcarbamoylamino)isoquinolin-8-yl]methyl]carbamate |
| SMILES | CCNC(=O)Nc1cc2cccc(CNC(=O)OCc3cccnc3)c2cn1 |
| InChI | InChI=1S/C20H21N5O3/c1-2-22-19(26)25-18-9-15-6-3-7-16(17(15)12-23-18)11-24-20(27)28-13-14-5-4-8-21-10-14/h3-10,12H,2,11,13H2,1H3,(H,24,27)(H2,22,23,25,26) |
| InChIKey | VUBWPQRMKRTDTA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |