C24H33N3O5S — CID 67451014
3-ethoxy-6-[4-[4-(4-methylsulfonylphenoxy)cyclohexyl]oxypiperidin-1-yl]pyridazine (PubChem CID 67451014) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is 3-ethoxy-6-[4-[4-(4-methylsulfonylphenoxy)cyclohexyl]oxypiperidin-1-yl]pyridazine.
| Compound Name | 3-ethoxy-6-[4-[4-(4-methylsulfonylphenoxy)cyclohexyl]oxypiperidin-1-yl]pyridazine |
|---|---|
| PubChem CID | 67451014 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 3-ethoxy-6-[4-[4-(4-methylsulfonylphenoxy)cyclohexyl]oxypiperidin-1-yl]pyridazine |
| SMILES | CCOc1ccc(N2CCC(OC3CCC(Oc4ccc(S(C)(=O)=O)cc4)CC3)CC2)nn1 |
| InChI | InChI=1S/C24H33N3O5S/c1-3-30-24-13-12-23(25-26-24)27-16-14-21(15-17-27)32-19-6-4-18(5-7-19)31-20-8-10-22(11-9-20)33(2,28)29/h8-13,18-19,21H,3-7,14-17H2,1-2H3 |
| InChIKey | YHZHUSNVJPIZMU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |