C17H13F2NO4 — CID 67453021
ethyl (E)-3-[8-(difluoromethoxy)-[1]benzofuro[2,3-c]pyridin-5-yl]prop-2-enoate (PubChem CID 67453021) has the molecular formula C17H13F2NO4 and a molecular weight of 333.29 g/mol. Its IUPAC name is ethyl (E)-3-[8-(difluoromethoxy)-[1]benzofuro[2,3-c]pyridin-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[8-(difluoromethoxy)-[1]benzofuro[2,3-c]pyridin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67453021 |
| Molecular Formula | C17H13F2NO4 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | ethyl (E)-3-[8-(difluoromethoxy)-[1]benzofuro[2,3-c]pyridin-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(OC(F)F)c2oc3cnccc3c12 |
| InChI | InChI=1S/C17H13F2NO4/c1-2-22-14(21)6-4-10-3-5-12(24-17(18)19)16-15(10)11-7-8-20-9-13(11)23-16/h3-9,17H,2H2,1H3/b6-4+ |
| InChIKey | PMWSYHOBGZFTMT-GQCTYLIASA-N |
| XLogP | 4.16 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|