C20H20N2O6 — CID 87407018
ethyl 3-[8-(cyclopropylmethoxy)-[1]benzofuro[2,3-c]pyridin-5-yl]-3-nitropropanoate (PubChem CID 87407018) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is ethyl 3-[8-(cyclopropylmethoxy)-[1]benzofuro[2,3-c]pyridin-5-yl]-3-nitropropanoate.
| Compound Name | ethyl 3-[8-(cyclopropylmethoxy)-[1]benzofuro[2,3-c]pyridin-5-yl]-3-nitropropanoate |
|---|---|
| PubChem CID | 87407018 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | ethyl 3-[8-(cyclopropylmethoxy)-[1]benzofuro[2,3-c]pyridin-5-yl]-3-nitropropanoate |
| SMILES | CCOC(=O)CC(c1ccc(OCC2CC2)c2oc3cnccc3c12)[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N2O6/c1-2-26-18(23)9-15(22(24)25)13-5-6-16(27-11-12-3-4-12)20-19(13)14-7-8-21-10-17(14)28-20/h5-8,10,12,15H,2-4,9,11H2,1H3 |
| InChIKey | BOYKSAQADOFTGD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|