C23H29NO3 — CID 58150497
ethyl 2-[4-(cyclopropylmethoxy)-3-pyridin-4-ylphenyl]-4-methylpentanoate (PubChem CID 58150497) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethyl 2-[4-(cyclopropylmethoxy)-3-pyridin-4-ylphenyl]-4-methylpentanoate.
| Compound Name | ethyl 2-[4-(cyclopropylmethoxy)-3-pyridin-4-ylphenyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 58150497 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | ethyl 2-[4-(cyclopropylmethoxy)-3-pyridin-4-ylphenyl]-4-methylpentanoate |
| SMILES | CCOC(=O)C(CC(C)C)c1ccc(OCC2CC2)c(-c2ccncc2)c1 |
| InChI | InChI=1S/C23H29NO3/c1-4-26-23(25)21(13-16(2)3)19-7-8-22(27-15-17-5-6-17)20(14-19)18-9-11-24-12-10-18/h7-12,14,16-17,21H,4-6,13,15H2,1-3H3 |
| InChIKey | JINLVTOFKYANOD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |