C46H53BBrF9O8 — CID 162018547
ethyl 2-[3-bromo-4-(2,2,2-trifluoroethoxy)phenyl]-4-methylpentanoate;ethyl 4-methyl-2-[4-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]pentanoate;(4-methylphenyl)boronic acid (PubChem CID 162018547) has the molecular formula C46H53BBrF9O8 and a molecular weight of 995.62 g/mol. Its IUPAC name is ethyl 2-[3-bromo-4-(2,2,2-trifluoroethoxy)phenyl]-4-methylpentanoate;ethyl 4-methyl-2-[4-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]pentanoate;(4-methylphenyl)boronic acid.
| Compound Name | ethyl 2-[3-bromo-4-(2,2,2-trifluoroethoxy)phenyl]-4-methylpentanoate;ethyl 4-methyl-2-[4-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]pentanoate;(4-methylphenyl)boronic acid |
|---|---|
| PubChem CID | 162018547 |
| Molecular Formula | C46H53BBrF9O8 |
| Molecular Weight | 995.62 g/mol |
| Exact Mass | 994.29 |
| IUPAC Name | ethyl 2-[3-bromo-4-(2,2,2-trifluoroethoxy)phenyl]-4-methylpentanoate;ethyl 4-methyl-2-[4-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]pentanoate;(4-methylphenyl)boronic acid |
| SMILES | CCOC(=O)C(CC(C)C)c1ccc(OCC(F)(F)F)c(-c2ccc(C(F)(F)F)cc2)c1.CCOC(=O)C(CC(C)C)c1ccc(OCC(F)(F)F)c(Br)c1.Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C23H24F6O3.C16H20BrF3O3.C7H9BO2/c1-4-31-21(30)19(11-14(2)3)16-7-10-20(32-13-22(24,25)26)18(12-16)15-5-8-17(9-6-15)23(27,28)29;1-4-22-15(21)12(7-10(2)3)11-5-6-14(13(17)8-11)23-9-16(18,19)20;1-6-2-4-7(5-3-6)8(9)10/h5-10,12,14,19H,4,11,13H2,1-3H3;5-6,8,10,12H,4,7,9H2,1-3H3;2-5,9-10H,1H3 |
| InChIKey | YULCVEQIHZNQKA-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.62 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|