C16H20BrF3O3 — CID 140561613
ethyl 2-[[3-bromo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]pentanoate (PubChem CID 140561613) has the molecular formula C16H20BrF3O3 and a molecular weight of 397.23 g/mol. Its IUPAC name is ethyl 2-[[3-bromo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]pentanoate.
| Compound Name | ethyl 2-[[3-bromo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]pentanoate |
|---|---|
| PubChem CID | 140561613 |
| Molecular Formula | C16H20BrF3O3 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | ethyl 2-[[3-bromo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]pentanoate |
| SMILES | CCCC(Cc1ccc(OCC(F)(F)F)c(Br)c1)C(=O)OCC |
| InChI | InChI=1S/C16H20BrF3O3/c1-3-5-12(15(21)22-4-2)8-11-6-7-14(13(17)9-11)23-10-16(18,19)20/h6-7,9,12H,3-5,8,10H2,1-2H3 |
| InChIKey | ZQTVHSAQPWSVCK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |