C23H25F3O2 — CID 88975610
2-[4-(cyclopropylmethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanal (PubChem CID 88975610) has the molecular formula C23H25F3O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-[4-(cyclopropylmethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanal.
| Compound Name | 2-[4-(cyclopropylmethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanal |
|---|---|
| PubChem CID | 88975610 |
| Molecular Formula | C23H25F3O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-[4-(cyclopropylmethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanal |
| SMILES | CC(C)CC(C=O)c1ccc(OCC2CC2)c(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C23H25F3O2/c1-15(2)11-19(13-27)18-7-10-22(28-14-16-3-4-16)21(12-18)17-5-8-20(9-6-17)23(24,25)26/h5-10,12-13,15-16,19H,3-4,11,14H2,1-2H3 |
| InChIKey | QCFSKSDYTMWQJL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|