C24H29ClO3 — CID 68854756
ethyl 2-[2-chloro-4-(cyclopropylmethoxy)-5-phenylphenyl]-4-methylpentanoate (PubChem CID 68854756) has the molecular formula C24H29ClO3 and a molecular weight of 400.95 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-(cyclopropylmethoxy)-5-phenylphenyl]-4-methylpentanoate.
| Compound Name | ethyl 2-[2-chloro-4-(cyclopropylmethoxy)-5-phenylphenyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 68854756 |
| Molecular Formula | C24H29ClO3 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | ethyl 2-[2-chloro-4-(cyclopropylmethoxy)-5-phenylphenyl]-4-methylpentanoate |
| SMILES | CCOC(=O)C(CC(C)C)c1cc(-c2ccccc2)c(OCC2CC2)cc1Cl |
| InChI | InChI=1S/C24H29ClO3/c1-4-27-24(26)21(12-16(2)3)20-13-19(18-8-6-5-7-9-18)23(14-22(20)25)28-15-17-10-11-17/h5-9,13-14,16-17,21H,4,10-12,15H2,1-3H3 |
| InChIKey | LDZBUFAAVNRRPE-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |