C25H32O4 — CID 58150533
ethyl 2-[4-(cyclopropylmethoxy)-3-(4-methoxyphenyl)phenyl]-4-methylpentanoate (PubChem CID 58150533) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is ethyl 2-[4-(cyclopropylmethoxy)-3-(4-methoxyphenyl)phenyl]-4-methylpentanoate.
| Compound Name | ethyl 2-[4-(cyclopropylmethoxy)-3-(4-methoxyphenyl)phenyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 58150533 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | ethyl 2-[4-(cyclopropylmethoxy)-3-(4-methoxyphenyl)phenyl]-4-methylpentanoate |
| SMILES | CCOC(=O)C(CC(C)C)c1ccc(OCC2CC2)c(-c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C25H32O4/c1-5-28-25(26)23(14-17(2)3)20-10-13-24(29-16-18-6-7-18)22(15-20)19-8-11-21(27-4)12-9-19/h8-13,15,17-18,23H,5-7,14,16H2,1-4H3 |
| InChIKey | BCDRFEKLTWUBNP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |