C23H28O3 — CID 58150506
2-[4-(cyclopropylmethoxy)-3-(3-methylphenyl)phenyl]-4-methylpentanoic acid (PubChem CID 58150506) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-[4-(cyclopropylmethoxy)-3-(3-methylphenyl)phenyl]-4-methylpentanoic acid.
| Compound Name | 2-[4-(cyclopropylmethoxy)-3-(3-methylphenyl)phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 58150506 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-[4-(cyclopropylmethoxy)-3-(3-methylphenyl)phenyl]-4-methylpentanoic acid |
| SMILES | Cc1cccc(-c2cc(C(CC(C)C)C(=O)O)ccc2OCC2CC2)c1 |
| InChI | InChI=1S/C23H28O3/c1-15(2)11-21(23(24)25)19-9-10-22(26-14-17-7-8-17)20(13-19)18-6-4-5-16(3)12-18/h4-6,9-10,12-13,15,17,21H,7-8,11,14H2,1-3H3,(H,24,25) |
| InChIKey | ZZVDJCKANZEKKZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |