C24H28Cl3N3O5S — CID 67455485
1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[[1-(2,4,6-trichlorophenyl)sulfonylpyrrolidin-2-yl]methoxy]ethanone (PubChem CID 67455485) has the molecular formula C24H28Cl3N3O5S and a molecular weight of 576.93 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[[1-(2,4,6-trichlorophenyl)sulfonylpyrrolidin-2-yl]methoxy]ethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[[1-(2,4,6-trichlorophenyl)sulfonylpyrrolidin-2-yl]methoxy]ethanone |
|---|---|
| PubChem CID | 67455485 |
| Molecular Formula | C24H28Cl3N3O5S |
| Molecular Weight | 576.93 g/mol |
| Exact Mass | 575.08 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[[1-(2,4,6-trichlorophenyl)sulfonylpyrrolidin-2-yl]methoxy]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)COCC3CCCN3S(=O)(=O)c3c(Cl)cc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C24H28Cl3N3O5S/c1-34-20-6-4-18(5-7-20)28-9-11-29(12-10-28)23(31)16-35-15-19-3-2-8-30(19)36(32,33)24-21(26)13-17(25)14-22(24)27/h4-7,13-14,19H,2-3,8-12,15-16H2,1H3 |
| InChIKey | NZRPPZMMHAPCNW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.93 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|