C13H15Cl2NO5S — CID 59746470
2-[[1-(2,6-dichlorophenyl)sulfonylpyrrolidin-2-yl]methoxy]acetic acid (PubChem CID 59746470) has the molecular formula C13H15Cl2NO5S and a molecular weight of 368.24 g/mol. Its IUPAC name is 2-[[1-(2,6-dichlorophenyl)sulfonylpyrrolidin-2-yl]methoxy]acetic acid.
| Compound Name | 2-[[1-(2,6-dichlorophenyl)sulfonylpyrrolidin-2-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 59746470 |
| Molecular Formula | C13H15Cl2NO5S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 2-[[1-(2,6-dichlorophenyl)sulfonylpyrrolidin-2-yl]methoxy]acetic acid |
| SMILES | O=C(O)COCC1CCCN1S(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H15Cl2NO5S/c14-10-4-1-5-11(15)13(10)22(19,20)16-6-2-3-9(16)7-21-8-12(17)18/h1,4-5,9H,2-3,6-8H2,(H,17,18) |
| InChIKey | LSAGGGPSSQQFAB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |