C14H17Cl2NO5S — CID 129385003
2-[[(2S)-1-(2,3-dichlorophenyl)sulfonylpiperidin-2-yl]methoxy]acetic acid (PubChem CID 129385003) has the molecular formula C14H17Cl2NO5S and a molecular weight of 382.27 g/mol. Its IUPAC name is 2-[[(2S)-1-(2,3-dichlorophenyl)sulfonylpiperidin-2-yl]methoxy]acetic acid.
| Compound Name | 2-[[(2S)-1-(2,3-dichlorophenyl)sulfonylpiperidin-2-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 129385003 |
| Molecular Formula | C14H17Cl2NO5S |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 2-[[(2S)-1-(2,3-dichlorophenyl)sulfonylpiperidin-2-yl]methoxy]acetic acid |
| SMILES | O=C(O)COC[C@@H]1CCCCN1S(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H17Cl2NO5S/c15-11-5-3-6-12(14(11)16)23(20,21)17-7-2-1-4-10(17)8-22-9-13(18)19/h3,5-6,10H,1-2,4,7-9H2,(H,18,19)/t10-/m0/s1 |
| InChIKey | FVKTXVIVJPCRPO-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |