C15H19Cl2NO5S — CID 68722665
2-[2-[1-(2,3-dichlorophenyl)sulfonylpiperidin-2-yl]ethoxy]acetic acid (PubChem CID 68722665) has the molecular formula C15H19Cl2NO5S and a molecular weight of 396.29 g/mol. Its IUPAC name is 2-[2-[1-(2,3-dichlorophenyl)sulfonylpiperidin-2-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[1-(2,3-dichlorophenyl)sulfonylpiperidin-2-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 68722665 |
| Molecular Formula | C15H19Cl2NO5S |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-[2-[1-(2,3-dichlorophenyl)sulfonylpiperidin-2-yl]ethoxy]acetic acid |
| SMILES | O=C(O)COCCC1CCCCN1S(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H19Cl2NO5S/c16-12-5-3-6-13(15(12)17)24(21,22)18-8-2-1-4-11(18)7-9-23-10-14(19)20/h3,5-6,11H,1-2,4,7-10H2,(H,19,20) |
| InChIKey | KCPWLYLQNMUWAD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|