C15H20ClNO5S — CID 69319727
2-[[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-2-yl]methoxy]acetic acid (PubChem CID 69319727) has the molecular formula C15H20ClNO5S and a molecular weight of 361.85 g/mol. Its IUPAC name is 2-[[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-2-yl]methoxy]acetic acid.
| Compound Name | 2-[[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-2-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 69319727 |
| Molecular Formula | C15H20ClNO5S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-[[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-2-yl]methoxy]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2COCC(=O)O)cc1Cl |
| InChI | InChI=1S/C15H20ClNO5S/c1-11-5-6-13(8-14(11)16)23(20,21)17-7-3-2-4-12(17)9-22-10-15(18)19/h5-6,8,12H,2-4,7,9-10H2,1H3,(H,18,19) |
| InChIKey | GUIKUDHOUGMUFB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |