C21H25N3O5 — CID 67455942
ethyl 2-[[3-[[methyl(phenylmethoxycarbonyl)amino]methyl]phenyl]carbamoylamino]acetate (PubChem CID 67455942) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl 2-[[3-[[methyl(phenylmethoxycarbonyl)amino]methyl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[3-[[methyl(phenylmethoxycarbonyl)amino]methyl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 67455942 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | ethyl 2-[[3-[[methyl(phenylmethoxycarbonyl)amino]methyl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1cccc(CN(C)C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H25N3O5/c1-3-28-19(25)13-22-20(26)23-18-11-7-10-17(12-18)14-24(2)21(27)29-15-16-8-5-4-6-9-16/h4-12H,3,13-15H2,1-2H3,(H2,22,23,26) |
| InChIKey | ZOECFYHFKOGSFR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |