C11H16FN3O2 — CID 67456067
tert-butyl-[2-(5-fluoropyrimidin-2-yl)ethyl]carbamic acid (PubChem CID 67456067) has the molecular formula C11H16FN3O2 and a molecular weight of 241.27 g/mol. Its IUPAC name is tert-butyl-[2-(5-fluoropyrimidin-2-yl)ethyl]carbamic acid.
| Compound Name | tert-butyl-[2-(5-fluoropyrimidin-2-yl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 67456067 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | tert-butyl-[2-(5-fluoropyrimidin-2-yl)ethyl]carbamic acid |
| SMILES | CC(C)(C)N(CCc1ncc(F)cn1)C(=O)O |
| InChI | InChI=1S/C11H16FN3O2/c1-11(2,3)15(10(16)17)5-4-9-13-6-8(12)7-14-9/h6-7H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | FDXORAYUIXLBRO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |