About dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate
dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate (PubChem CID 67458784) has the molecular formula C11H14N4O3
and a molecular weight of 250.26 g/mol. Its IUPAC name is dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate.
Molecular Properties
| Compound Name | dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate |
| PubChem CID | 67458784 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate |
| SMILES | C[NH2+]C.O=[N+]([O-])c1cccc(-c2cn[nH]c2[O-])c1 |
| InChI | InChI=1S/C9H7N3O3.C2H7N/c13-9-8(5-10-11-9)6-2-1-3-7(4-6)12(14)15;1-3-2/h1-5H,(H2,10,11,13);3H,1-2H3 |
| InChIKey | XLRNTAJVZKERDY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate?
The IUPAC name of dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate (CID 67458784) is dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate.
What is the SMILES notation for dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate?
The canonical SMILES for dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate is C[NH2+]C.O=[N+]([O-])c1cccc(-c2cn[nH]c2[O-])c1.
What is the InChIKey of dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate?
The InChIKey is XLRNTAJVZKERDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O3.C2H7N/c13-9-8(5-10-11-9)6-2-1-3-7(4-6)12(14)15;1-3-2/h1-5H,(H2,10,11,13);3H,1-2H3.
What are the key properties of dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate?
dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate has a molecular weight of 250.26 g/mol, XLogP of -0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylazanium;4-(3-nitrophenyl)-1H-pyrazol-5-olate is sourced from PubChem (CID 67458784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).