C19H20F3NO3 — CID 67461399
(E)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4,5-trifluorophenyl)piperidin-2-yl]-2-methylprop-2-enoic acid (PubChem CID 67461399) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is (E)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4,5-trifluorophenyl)piperidin-2-yl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4,5-trifluorophenyl)piperidin-2-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67461399 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (E)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4,5-trifluorophenyl)piperidin-2-yl]-2-methylprop-2-enoic acid |
| SMILES | C=CCC(=O)N1[C@@H](/C=C(\C)C(=O)O)CCC[C@H]1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H20F3NO3/c1-3-5-17(24)23-13(8-11(2)19(25)26)6-4-7-16(23)12-9-14(20)18(22)15(21)10-12/h3,8-10,13,16H,1,4-7H2,2H3,(H,25,26)/b11-8+/t13-,16+/m1/s1 |
| InChIKey | GKRNAEVSPZQLQM-HDEOUBMNSA-N |
| XLogP | 4.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|