C20H16FN7 — CID 67464456
4-amino-6-[2-(6-fluoro-1-phenylbenzimidazol-2-yl)ethylamino]pyrimidine-5-carbonitrile (PubChem CID 67464456) has the molecular formula C20H16FN7 and a molecular weight of 373.40 g/mol. Its IUPAC name is 4-amino-6-[2-(6-fluoro-1-phenylbenzimidazol-2-yl)ethylamino]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-[2-(6-fluoro-1-phenylbenzimidazol-2-yl)ethylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 67464456 |
| Molecular Formula | C20H16FN7 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-amino-6-[2-(6-fluoro-1-phenylbenzimidazol-2-yl)ethylamino]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)ncnc1NCCc1nc2ccc(F)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C20H16FN7/c21-13-6-7-16-17(10-13)28(14-4-2-1-3-5-14)18(27-16)8-9-24-20-15(11-22)19(23)25-12-26-20/h1-7,10,12H,8-9H2,(H3,23,24,25,26) |
| InChIKey | PELIWPCAJPURSV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |